About 2-[[4,5-bis(4-chlorophenyl)-1,3-thiazol-2-yl]sulfanyl]acetamide
2-[[4,5-bis(4-chlorophenyl)-1,3-thiazol-2-yl]sulfanyl]acetamide (PubChem CID 21408453) has the molecular formula C17H12Cl2N2OS2
and a molecular weight of 395.34 g/mol. Its IUPAC name is 2-[[4,5-bis(4-chlorophenyl)-1,3-thiazol-2-yl]sulfanyl]acetamide.
Molecular Properties
| Compound Name | 2-[[4,5-bis(4-chlorophenyl)-1,3-thiazol-2-yl]sulfanyl]acetamide |
| PubChem CID | 21408453 |
| Molecular Formula | C17H12Cl2N2OS2 |
| Molecular Weight | 395.34 g/mol |
| Exact Mass | 393.98 |
| IUPAC Name | 2-[[4,5-bis(4-chlorophenyl)-1,3-thiazol-2-yl]sulfanyl]acetamide |
| SMILES | NC(=O)CSc1nc(-c2ccc(Cl)cc2)c(-c2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C17H12Cl2N2OS2/c18-12-5-1-10(2-6-12)15-16(11-3-7-13(19)8-4-11)24-17(21-15)23-9-14(20)22/h1-8H,9H2,(H2,20,22) |
| InChIKey | INECFKQLDKMDNG-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 395.34 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[[4,5-bis(4-chlorophenyl)-1,3-thiazol-2-yl]sulfanyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[4,5-bis(4-chlorophenyl)-1,3-thiazol-2-yl]sulfanyl]acetamide?
The IUPAC name of 2-[[4,5-bis(4-chlorophenyl)-1,3-thiazol-2-yl]sulfanyl]acetamide (CID 21408453) is 2-[[4,5-bis(4-chlorophenyl)-1,3-thiazol-2-yl]sulfanyl]acetamide.
What is the SMILES notation for 2-[[4,5-bis(4-chlorophenyl)-1,3-thiazol-2-yl]sulfanyl]acetamide?
The canonical SMILES for 2-[[4,5-bis(4-chlorophenyl)-1,3-thiazol-2-yl]sulfanyl]acetamide is NC(=O)CSc1nc(-c2ccc(Cl)cc2)c(-c2ccc(Cl)cc2)s1.
What is the InChIKey of 2-[[4,5-bis(4-chlorophenyl)-1,3-thiazol-2-yl]sulfanyl]acetamide?
The InChIKey is INECFKQLDKMDNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12Cl2N2OS2/c18-12-5-1-10(2-6-12)15-16(11-3-7-13(19)8-4-11)24-17(21-15)23-9-14(20)22/h1-8H,9H2,(H2,20,22).
What are the key properties of 2-[[4,5-bis(4-chlorophenyl)-1,3-thiazol-2-yl]sulfanyl]acetamide?
2-[[4,5-bis(4-chlorophenyl)-1,3-thiazol-2-yl]sulfanyl]acetamide has a molecular weight of 395.34 g/mol, XLogP of 5.36, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[4,5-bis(4-chlorophenyl)-1,3-thiazol-2-yl]sulfanyl]acetamide is sourced from PubChem (CID 21408453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).