C17H12Cl2N2OS2 — CID 21408453
2-[[4,5-bis(4-chlorophenyl)-1,3-thiazol-2-yl]sulfanyl]acetamide (PubChem CID 21408453) has the molecular formula C17H12Cl2N2OS2 and a molecular weight of 395.34 g/mol. Its IUPAC name is 2-[[4,5-bis(4-chlorophenyl)-1,3-thiazol-2-yl]sulfanyl]acetamide.
| Compound Name | 2-[[4,5-bis(4-chlorophenyl)-1,3-thiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 21408453 |
| Molecular Formula | C17H12Cl2N2OS2 |
| Molecular Weight | 395.34 g/mol |
| Exact Mass | 393.98 |
| IUPAC Name | 2-[[4,5-bis(4-chlorophenyl)-1,3-thiazol-2-yl]sulfanyl]acetamide |
| SMILES | NC(=O)CSc1nc(-c2ccc(Cl)cc2)c(-c2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C17H12Cl2N2OS2/c18-12-5-1-10(2-6-12)15-16(11-3-7-13(19)8-4-11)24-17(21-15)23-9-14(20)22/h1-8H,9H2,(H2,20,22) |
| InChIKey | INECFKQLDKMDNG-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.34 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |