C15H9Cl2NOS — CID 21409060
4-[2-chloro-5-(4-chlorophenyl)-1,3-thiazol-4-yl]phenol (PubChem CID 21409060) has the molecular formula C15H9Cl2NOS and a molecular weight of 322.22 g/mol. Its IUPAC name is 4-[2-chloro-5-(4-chlorophenyl)-1,3-thiazol-4-yl]phenol.
| Compound Name | 4-[2-chloro-5-(4-chlorophenyl)-1,3-thiazol-4-yl]phenol |
|---|---|
| PubChem CID | 21409060 |
| Molecular Formula | C15H9Cl2NOS |
| Molecular Weight | 322.22 g/mol |
| Exact Mass | 320.98 |
| IUPAC Name | 4-[2-chloro-5-(4-chlorophenyl)-1,3-thiazol-4-yl]phenol |
| SMILES | Oc1ccc(-c2nc(Cl)sc2-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C15H9Cl2NOS/c16-11-5-1-10(2-6-11)14-13(18-15(17)20-14)9-3-7-12(19)8-4-9/h1-8,19H |
| InChIKey | COHISOYUFOKUKN-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.22 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |