C24H31NOS2 — CID 169104011
1-[(4,5-diphenyl-1,3-thiazol-2-yl)sulfanyl]propan-2-one;propane (PubChem CID 169104011) has the molecular formula C24H31NOS2 and a molecular weight of 413.65 g/mol. Its IUPAC name is 1-[(4,5-diphenyl-1,3-thiazol-2-yl)sulfanyl]propan-2-one;propane.
| Compound Name | 1-[(4,5-diphenyl-1,3-thiazol-2-yl)sulfanyl]propan-2-one;propane |
|---|---|
| PubChem CID | 169104011 |
| Molecular Formula | C24H31NOS2 |
| Molecular Weight | 413.65 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | 1-[(4,5-diphenyl-1,3-thiazol-2-yl)sulfanyl]propan-2-one;propane |
| SMILES | CC(=O)CSc1nc(-c2ccccc2)c(-c2ccccc2)s1.CCC.CCC |
| InChI | InChI=1S/C18H15NOS2.2C3H8/c1-13(20)12-21-18-19-16(14-8-4-2-5-9-14)17(22-18)15-10-6-3-7-11-15;2*1-3-2/h2-11H,12H2,1H3;2*3H2,1-2H3 |
| InChIKey | NMBMCQAQAPVQIF-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.65 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |