About 1-[(2-methyl-7-phenyl-[1,3]thiazolo[5,4-d]pyrimidin-5-yl)sulfanyl]propan-2-one
1-[(2-methyl-7-phenyl-[1,3]thiazolo[5,4-d]pyrimidin-5-yl)sulfanyl]propan-2-one (PubChem CID 51700685) has the molecular formula C15H13N3OS2
and a molecular weight of 315.42 g/mol. Its IUPAC name is 1-[(2-methyl-7-phenyl-[1,3]thiazolo[5,4-d]pyrimidin-5-yl)sulfanyl]propan-2-one.
Molecular Properties
| Compound Name | 1-[(2-methyl-7-phenyl-[1,3]thiazolo[5,4-d]pyrimidin-5-yl)sulfanyl]propan-2-one |
| PubChem CID | 51700685 |
| Molecular Formula | C15H13N3OS2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | 1-[(2-methyl-7-phenyl-[1,3]thiazolo[5,4-d]pyrimidin-5-yl)sulfanyl]propan-2-one |
| SMILES | CC(=O)CSc1nc(-c2ccccc2)c2nc(C)sc2n1 |
| InChI | InChI=1S/C15H13N3OS2/c1-9(19)8-20-15-17-12(11-6-4-3-5-7-11)13-14(18-15)21-10(2)16-13/h3-7H,8H2,1-2H3 |
| InChIKey | FGLSHJKBERNWAS-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 55.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[(2-methyl-7-phenyl-[1,3]thiazolo[5,4-d]pyrimidin-5-yl)sulfanyl]propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2-methyl-7-phenyl-[1,3]thiazolo[5,4-d]pyrimidin-5-yl)sulfanyl]propan-2-one?
The IUPAC name of 1-[(2-methyl-7-phenyl-[1,3]thiazolo[5,4-d]pyrimidin-5-yl)sulfanyl]propan-2-one (CID 51700685) is 1-[(2-methyl-7-phenyl-[1,3]thiazolo[5,4-d]pyrimidin-5-yl)sulfanyl]propan-2-one.
What is the SMILES notation for 1-[(2-methyl-7-phenyl-[1,3]thiazolo[5,4-d]pyrimidin-5-yl)sulfanyl]propan-2-one?
The canonical SMILES for 1-[(2-methyl-7-phenyl-[1,3]thiazolo[5,4-d]pyrimidin-5-yl)sulfanyl]propan-2-one is CC(=O)CSc1nc(-c2ccccc2)c2nc(C)sc2n1.
What is the InChIKey of 1-[(2-methyl-7-phenyl-[1,3]thiazolo[5,4-d]pyrimidin-5-yl)sulfanyl]propan-2-one?
The InChIKey is FGLSHJKBERNWAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13N3OS2/c1-9(19)8-20-15-17-12(11-6-4-3-5-7-11)13-14(18-15)21-10(2)16-13/h3-7H,8H2,1-2H3.
What are the key properties of 1-[(2-methyl-7-phenyl-[1,3]thiazolo[5,4-d]pyrimidin-5-yl)sulfanyl]propan-2-one?
1-[(2-methyl-7-phenyl-[1,3]thiazolo[5,4-d]pyrimidin-5-yl)sulfanyl]propan-2-one has a molecular weight of 315.42 g/mol, XLogP of 3.74, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2-methyl-7-phenyl-[1,3]thiazolo[5,4-d]pyrimidin-5-yl)sulfanyl]propan-2-one is sourced from PubChem (CID 51700685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).