C13H13NO2S2 — CID 13441328
ethyl 2-methylsulfanyl-4-phenyl-1,3-thiazole-5-carboxylate (PubChem CID 13441328) has the molecular formula C13H13NO2S2 and a molecular weight of 279.39 g/mol. Its IUPAC name is ethyl 2-methylsulfanyl-4-phenyl-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-methylsulfanyl-4-phenyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 13441328 |
| Molecular Formula | C13H13NO2S2 |
| Molecular Weight | 279.39 g/mol |
| Exact Mass | 279.04 |
| IUPAC Name | ethyl 2-methylsulfanyl-4-phenyl-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(SC)nc1-c1ccccc1 |
| InChI | InChI=1S/C13H13NO2S2/c1-3-16-12(15)11-10(14-13(17-2)18-11)9-7-5-4-6-8-9/h4-8H,3H2,1-2H3 |
| InChIKey | ZNTCESMRZDHVPB-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.39 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |