C18H13Cl2NO2S2 — CID 21408439
2-[[4,5-bis(4-chlorophenyl)-1,3-thiazol-2-yl]sulfanyl]propanoic acid (PubChem CID 21408439) has the molecular formula C18H13Cl2NO2S2 and a molecular weight of 410.35 g/mol. Its IUPAC name is 2-[[4,5-bis(4-chlorophenyl)-1,3-thiazol-2-yl]sulfanyl]propanoic acid.
| Compound Name | 2-[[4,5-bis(4-chlorophenyl)-1,3-thiazol-2-yl]sulfanyl]propanoic acid |
|---|---|
| PubChem CID | 21408439 |
| Molecular Formula | C18H13Cl2NO2S2 |
| Molecular Weight | 410.35 g/mol |
| Exact Mass | 408.98 |
| IUPAC Name | 2-[[4,5-bis(4-chlorophenyl)-1,3-thiazol-2-yl]sulfanyl]propanoic acid |
| SMILES | CC(Sc1nc(-c2ccc(Cl)cc2)c(-c2ccc(Cl)cc2)s1)C(=O)O |
| InChI | InChI=1S/C18H13Cl2NO2S2/c1-10(17(22)23)24-18-21-15(11-2-6-13(19)7-3-11)16(25-18)12-4-8-14(20)9-5-12/h2-10H,1H3,(H,22,23) |
| InChIKey | RDLFFQVGKIJSRD-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.35 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |