C17H13ClN2O2S2 — CID 152780654
2-[5-(4-aminophenyl)-4-(4-chlorophenyl)-1,3-thiazol-2-yl]-2-sulfanylacetic acid (PubChem CID 152780654) has the molecular formula C17H13ClN2O2S2 and a molecular weight of 376.89 g/mol. Its IUPAC name is 2-[5-(4-aminophenyl)-4-(4-chlorophenyl)-1,3-thiazol-2-yl]-2-sulfanylacetic acid.
| Compound Name | 2-[5-(4-aminophenyl)-4-(4-chlorophenyl)-1,3-thiazol-2-yl]-2-sulfanylacetic acid |
|---|---|
| PubChem CID | 152780654 |
| Molecular Formula | C17H13ClN2O2S2 |
| Molecular Weight | 376.89 g/mol |
| Exact Mass | 376.01 |
| IUPAC Name | 2-[5-(4-aminophenyl)-4-(4-chlorophenyl)-1,3-thiazol-2-yl]-2-sulfanylacetic acid |
| SMILES | Nc1ccc(-c2sc(C(S)C(=O)O)nc2-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C17H13ClN2O2S2/c18-11-5-1-9(2-6-11)13-15(10-3-7-12(19)8-4-10)24-16(20-13)14(23)17(21)22/h1-8,14,23H,19H2,(H,21,22) |
| InChIKey | QNKKTKJVTWZMDY-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.89 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|