C15H14N2O3S — CID 82226544
2-(cyclobutanecarbonylamino)-4-phenyl-1,3-thiazole-5-carboxylic acid (PubChem CID 82226544) has the molecular formula C15H14N2O3S and a molecular weight of 302.35 g/mol. Its IUPAC name is 2-(cyclobutanecarbonylamino)-4-phenyl-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-(cyclobutanecarbonylamino)-4-phenyl-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 82226544 |
| Molecular Formula | C15H14N2O3S |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 2-(cyclobutanecarbonylamino)-4-phenyl-1,3-thiazole-5-carboxylic acid |
| SMILES | O=C(O)c1sc(NC(=O)C2CCC2)nc1-c1ccccc1 |
| InChI | InChI=1S/C15H14N2O3S/c18-13(10-7-4-8-10)17-15-16-11(12(21-15)14(19)20)9-5-2-1-3-6-9/h1-3,5-6,10H,4,7-8H2,(H,19,20)(H,16,17,18) |
| InChIKey | JJRJYHIGYAKFOH-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |