C16H15N3OS — CID 87301470
N-(5-cyano-4-phenyl-1,3-thiazol-2-yl)cyclopentanecarboxamide (PubChem CID 87301470) has the molecular formula C16H15N3OS and a molecular weight of 297.38 g/mol. Its IUPAC name is N-(5-cyano-4-phenyl-1,3-thiazol-2-yl)cyclopentanecarboxamide.
| Compound Name | N-(5-cyano-4-phenyl-1,3-thiazol-2-yl)cyclopentanecarboxamide |
|---|---|
| PubChem CID | 87301470 |
| Molecular Formula | C16H15N3OS |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | N-(5-cyano-4-phenyl-1,3-thiazol-2-yl)cyclopentanecarboxamide |
| SMILES | N#Cc1sc(NC(=O)C2CCCC2)nc1-c1ccccc1 |
| InChI | InChI=1S/C16H15N3OS/c17-10-13-14(11-6-2-1-3-7-11)18-16(21-13)19-15(20)12-8-4-5-9-12/h1-3,6-7,12H,4-5,8-9H2,(H,18,19,20) |
| InChIKey | UGKVPUVYROTJKU-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |