C22H22N2OS — CID 2427902
N-(4,5-diphenyl-1,3-thiazol-2-yl)cyclohexanecarboxamide (PubChem CID 2427902) has the molecular formula C22H22N2OS and a molecular weight of 362.50 g/mol. Its IUPAC name is N-(4,5-diphenyl-1,3-thiazol-2-yl)cyclohexanecarboxamide.
| Compound Name | N-(4,5-diphenyl-1,3-thiazol-2-yl)cyclohexanecarboxamide |
|---|---|
| PubChem CID | 2427902 |
| Molecular Formula | C22H22N2OS |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | N-(4,5-diphenyl-1,3-thiazol-2-yl)cyclohexanecarboxamide |
| SMILES | O=C(Nc1nc(-c2ccccc2)c(-c2ccccc2)s1)C1CCCCC1 |
| InChI | InChI=1S/C22H22N2OS/c25-21(18-14-8-3-9-15-18)24-22-23-19(16-10-4-1-5-11-16)20(26-22)17-12-6-2-7-13-17/h1-2,4-7,10-13,18H,3,8-9,14-15H2,(H,23,24,25) |
| InChIKey | ZHMHWVZSZRJAGG-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |