C15H15N3O3S — CID 94970522
4-(4-aminophenyl)-2-(cyclobutanecarbonylamino)-1,3-thiazole-5-carboxylic acid (PubChem CID 94970522) has the molecular formula C15H15N3O3S and a molecular weight of 317.37 g/mol. Its IUPAC name is 4-(4-aminophenyl)-2-(cyclobutanecarbonylamino)-1,3-thiazole-5-carboxylic acid.
| Compound Name | 4-(4-aminophenyl)-2-(cyclobutanecarbonylamino)-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 94970522 |
| Molecular Formula | C15H15N3O3S |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | 4-(4-aminophenyl)-2-(cyclobutanecarbonylamino)-1,3-thiazole-5-carboxylic acid |
| SMILES | Nc1ccc(-c2nc(NC(=O)C3CCC3)sc2C(=O)O)cc1 |
| InChI | InChI=1S/C15H15N3O3S/c16-10-6-4-8(5-7-10)11-12(14(20)21)22-15(17-11)18-13(19)9-2-1-3-9/h4-7,9H,1-3,16H2,(H,20,21)(H,17,18,19) |
| InChIKey | GBOKMSHBTCVTHD-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|