C28H25N3O4S2 — CID 16828928
1-(benzenesulfonyl)-N-(5-benzoyl-4-phenyl-1,3-thiazol-2-yl)piperidine-3-carboxamide (PubChem CID 16828928) has the molecular formula C28H25N3O4S2 and a molecular weight of 531.66 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-N-(5-benzoyl-4-phenyl-1,3-thiazol-2-yl)piperidine-3-carboxamide.
| Compound Name | 1-(benzenesulfonyl)-N-(5-benzoyl-4-phenyl-1,3-thiazol-2-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 16828928 |
| Molecular Formula | C28H25N3O4S2 |
| Molecular Weight | 531.66 g/mol |
| Exact Mass | 531.13 |
| IUPAC Name | 1-(benzenesulfonyl)-N-(5-benzoyl-4-phenyl-1,3-thiazol-2-yl)piperidine-3-carboxamide |
| SMILES | O=C(c1ccccc1)c1sc(NC(=O)C2CCCN(S(=O)(=O)c3ccccc3)C2)nc1-c1ccccc1 |
| InChI | InChI=1S/C28H25N3O4S2/c32-25(21-13-6-2-7-14-21)26-24(20-11-4-1-5-12-20)29-28(36-26)30-27(33)22-15-10-18-31(19-22)37(34,35)23-16-8-3-9-17-23/h1-9,11-14,16-17,22H,10,15,18-19H2,(H,29,30,33) |
| InChIKey | QHCKMOLKOSLJJI-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.66 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |