C19H18FN3O3S2 — CID 16828884
1-(benzenesulfonyl)-N-(6-fluoro-1,3-benzothiazol-2-yl)piperidine-3-carboxamide (PubChem CID 16828884) has the molecular formula C19H18FN3O3S2 and a molecular weight of 419.50 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-N-(6-fluoro-1,3-benzothiazol-2-yl)piperidine-3-carboxamide.
| Compound Name | 1-(benzenesulfonyl)-N-(6-fluoro-1,3-benzothiazol-2-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 16828884 |
| Molecular Formula | C19H18FN3O3S2 |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.08 |
| IUPAC Name | 1-(benzenesulfonyl)-N-(6-fluoro-1,3-benzothiazol-2-yl)piperidine-3-carboxamide |
| SMILES | O=C(Nc1nc2ccc(F)cc2s1)C1CCCN(S(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C19H18FN3O3S2/c20-14-8-9-16-17(11-14)27-19(21-16)22-18(24)13-5-4-10-23(12-13)28(25,26)15-6-2-1-3-7-15/h1-3,6-9,11,13H,4-5,10,12H2,(H,21,22,24) |
| InChIKey | NOSJUASITVWPFG-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |