C22H14N4S2 — CID 10408580
2-[3-(4-sulfanylidene-1H-quinazolin-2-yl)phenyl]-1H-quinazoline-4-thione (PubChem CID 10408580) has the molecular formula C22H14N4S2 and a molecular weight of 398.52 g/mol. Its IUPAC name is 2-[3-(4-sulfanylidene-1H-quinazolin-2-yl)phenyl]-1H-quinazoline-4-thione.
| Compound Name | 2-[3-(4-sulfanylidene-1H-quinazolin-2-yl)phenyl]-1H-quinazoline-4-thione |
|---|---|
| PubChem CID | 10408580 |
| Molecular Formula | C22H14N4S2 |
| Molecular Weight | 398.52 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | 2-[3-(4-sulfanylidene-1H-quinazolin-2-yl)phenyl]-1H-quinazoline-4-thione |
| SMILES | S=c1nc(-c2cccc(-c3nc(=S)c4ccccc4[nH]3)c2)[nH]c2ccccc12 |
| InChI | InChI=1S/C22H14N4S2/c27-21-15-8-1-3-10-17(15)23-19(25-21)13-6-5-7-14(12-13)20-24-18-11-4-2-9-16(18)22(28)26-20/h1-12H,(H,23,25,27)(H,24,26,28) |
| InChIKey | INNHCXHEPMHAMN-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.52 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|