C22H11BrF3N3O — CID 177491779
9-amino-2-bromo-7-[4-(trifluoromethyl)phenyl]-6H-benzo[c]chromene-8,10-dicarbonitrile (PubChem CID 177491779) has the molecular formula C22H11BrF3N3O and a molecular weight of 470.25 g/mol. Its IUPAC name is 9-amino-2-bromo-7-[4-(trifluoromethyl)phenyl]-6H-benzo[c]chromene-8,10-dicarbonitrile.
| Compound Name | 9-amino-2-bromo-7-[4-(trifluoromethyl)phenyl]-6H-benzo[c]chromene-8,10-dicarbonitrile |
|---|---|
| PubChem CID | 177491779 |
| Molecular Formula | C22H11BrF3N3O |
| Molecular Weight | 470.25 g/mol |
| Exact Mass | 469.00 |
| IUPAC Name | 9-amino-2-bromo-7-[4-(trifluoromethyl)phenyl]-6H-benzo[c]chromene-8,10-dicarbonitrile |
| SMILES | N#Cc1c(N)c(C#N)c2c(c1-c1ccc(C(F)(F)F)cc1)COc1ccc(Br)cc1-2 |
| InChI | InChI=1S/C22H11BrF3N3O/c23-13-5-6-18-14(7-13)20-16(9-28)21(29)15(8-27)19(17(20)10-30-18)11-1-3-12(4-2-11)22(24,25)26/h1-7H,10,29H2 |
| InChIKey | MFXRISZPKMWIDA-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 82.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.25 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|