C22H14BrN3 — CID 56931940
3-amino-8-bromo-1-(3-methylphenyl)-9H-fluorene-2,4-dicarbonitrile (PubChem CID 56931940) has the molecular formula C22H14BrN3 and a molecular weight of 400.28 g/mol. Its IUPAC name is 3-amino-8-bromo-1-(3-methylphenyl)-9H-fluorene-2,4-dicarbonitrile.
| Compound Name | 3-amino-8-bromo-1-(3-methylphenyl)-9H-fluorene-2,4-dicarbonitrile |
|---|---|
| PubChem CID | 56931940 |
| Molecular Formula | C22H14BrN3 |
| Molecular Weight | 400.28 g/mol |
| Exact Mass | 399.04 |
| IUPAC Name | 3-amino-8-bromo-1-(3-methylphenyl)-9H-fluorene-2,4-dicarbonitrile |
| SMILES | Cc1cccc(-c2c(C#N)c(N)c(C#N)c3c2Cc2c(Br)cccc2-3)c1 |
| InChI | InChI=1S/C22H14BrN3/c1-12-4-2-5-13(8-12)20-16-9-15-14(6-3-7-19(15)23)21(16)18(11-25)22(26)17(20)10-24/h2-8H,9,26H2,1H3 |
| InChIKey | YBFLASHEVZYLMV-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 73.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.28 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|