C29H20BrN3O — CID 139203799
2-amino-4-(4-bromobenzoyl)-5,6-bis(3-methylphenyl)benzene-1,3-dicarbonitrile (PubChem CID 139203799) has the molecular formula C29H20BrN3O and a molecular weight of 506.40 g/mol. Its IUPAC name is 2-amino-4-(4-bromobenzoyl)-5,6-bis(3-methylphenyl)benzene-1,3-dicarbonitrile.
| Compound Name | 2-amino-4-(4-bromobenzoyl)-5,6-bis(3-methylphenyl)benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 139203799 |
| Molecular Formula | C29H20BrN3O |
| Molecular Weight | 506.40 g/mol |
| Exact Mass | 505.08 |
| IUPAC Name | 2-amino-4-(4-bromobenzoyl)-5,6-bis(3-methylphenyl)benzene-1,3-dicarbonitrile |
| SMILES | Cc1cccc(-c2c(C#N)c(N)c(C#N)c(C(=O)c3ccc(Br)cc3)c2-c2cccc(C)c2)c1 |
| InChI | InChI=1S/C29H20BrN3O/c1-17-5-3-7-20(13-17)25-23(15-31)28(33)24(16-32)27(26(25)21-8-4-6-18(2)14-21)29(34)19-9-11-22(30)12-10-19/h3-14H,33H2,1-2H3 |
| InChIKey | YJDUYXFMOCFUMP-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 90.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.40 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|