About 8-bromo-4H-chromeno[4,3-d][1,3]thiazol-2-amine
8-bromo-4H-chromeno[4,3-d][1,3]thiazol-2-amine (PubChem CID 23733727) has the molecular formula C10H7BrN2OS
and a molecular weight of 283.15 g/mol. Its IUPAC name is 8-bromo-4H-chromeno[4,3-d][1,3]thiazol-2-amine.
Molecular Properties
| Compound Name | 8-bromo-4H-chromeno[4,3-d][1,3]thiazol-2-amine |
| PubChem CID | 23733727 |
| Molecular Formula | C10H7BrN2OS |
| Molecular Weight | 283.15 g/mol |
| Exact Mass | 281.95 |
| IUPAC Name | 8-bromo-4H-chromeno[4,3-d][1,3]thiazol-2-amine |
| SMILES | Nc1nc2c(s1)COc1ccc(Br)cc1-2 |
| InChI | InChI=1S/C10H7BrN2OS/c11-5-1-2-7-6(3-5)9-8(4-14-7)15-10(12)13-9/h1-3H,4H2,(H2,12,13) |
| InChIKey | LJBCSBUVNRXUTD-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.15 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-bromo-4H-chromeno[4,3-d][1,3]thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-bromo-4H-chromeno[4,3-d][1,3]thiazol-2-amine?
The IUPAC name of 8-bromo-4H-chromeno[4,3-d][1,3]thiazol-2-amine (CID 23733727) is 8-bromo-4H-chromeno[4,3-d][1,3]thiazol-2-amine.
What is the SMILES notation for 8-bromo-4H-chromeno[4,3-d][1,3]thiazol-2-amine?
The canonical SMILES for 8-bromo-4H-chromeno[4,3-d][1,3]thiazol-2-amine is Nc1nc2c(s1)COc1ccc(Br)cc1-2.
What is the InChIKey of 8-bromo-4H-chromeno[4,3-d][1,3]thiazol-2-amine?
The InChIKey is LJBCSBUVNRXUTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7BrN2OS/c11-5-1-2-7-6(3-5)9-8(4-14-7)15-10(12)13-9/h1-3H,4H2,(H2,12,13).
What are the key properties of 8-bromo-4H-chromeno[4,3-d][1,3]thiazol-2-amine?
8-bromo-4H-chromeno[4,3-d][1,3]thiazol-2-amine has a molecular weight of 283.15 g/mol, XLogP of 3.05, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-bromo-4H-chromeno[4,3-d][1,3]thiazol-2-amine is sourced from PubChem (CID 23733727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).