C19H17N3O3 — CID 139237369
5-amino-7-(3,4-dimethoxyphenyl)-3-methyl-1,3-dihydro-2-benzofuran-4,6-dicarbonitrile (PubChem CID 139237369) has the molecular formula C19H17N3O3 and a molecular weight of 335.36 g/mol. Its IUPAC name is 5-amino-7-(3,4-dimethoxyphenyl)-3-methyl-1,3-dihydro-2-benzofuran-4,6-dicarbonitrile.
| Compound Name | 5-amino-7-(3,4-dimethoxyphenyl)-3-methyl-1,3-dihydro-2-benzofuran-4,6-dicarbonitrile |
|---|---|
| PubChem CID | 139237369 |
| Molecular Formula | C19H17N3O3 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | 5-amino-7-(3,4-dimethoxyphenyl)-3-methyl-1,3-dihydro-2-benzofuran-4,6-dicarbonitrile |
| SMILES | COc1ccc(-c2c(C#N)c(N)c(C#N)c3c2COC3C)cc1OC |
| InChI | InChI=1S/C19H17N3O3/c1-10-17-12(7-20)19(22)13(8-21)18(14(17)9-25-10)11-4-5-15(23-2)16(6-11)24-3/h4-6,10H,9,22H2,1-3H3 |
| InChIKey | UCRKRPXXSQROET-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|