C23H25N3O7 — CID 102417286
2-amino-4-(3,4-dimethoxyphenyl)-6-[[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]methyl]benzene-1,3-dicarbonitrile (PubChem CID 102417286) has the molecular formula C23H25N3O7 and a molecular weight of 455.47 g/mol. Its IUPAC name is 2-amino-4-(3,4-dimethoxyphenyl)-6-[[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]methyl]benzene-1,3-dicarbonitrile.
| Compound Name | 2-amino-4-(3,4-dimethoxyphenyl)-6-[[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]methyl]benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 102417286 |
| Molecular Formula | C23H25N3O7 |
| Molecular Weight | 455.47 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | 2-amino-4-(3,4-dimethoxyphenyl)-6-[[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]methyl]benzene-1,3-dicarbonitrile |
| SMILES | COc1ccc(-c2cc(C[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c(C#N)c(N)c2C#N)cc1OC |
| InChI | InChI=1S/C23H25N3O7/c1-31-16-4-3-11(6-17(16)32-2)13-5-12(14(8-24)20(26)15(13)9-25)7-18-21(28)23(30)22(29)19(10-27)33-18/h3-6,18-19,21-23,27-30H,7,10,26H2,1-2H3/t18-,19+,21-,22+,23+/m0/s1 |
| InChIKey | XVADPICMIHAMIG-RNJSZURPSA-N |
| XLogP | 0.08 |
| TPSA | 182.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.47 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|