C21H24N2O8 — CID 53473272
4-(3,4-dimethoxyphenyl)-2-oxo-6-[[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]methyl]-1H-pyridine-3-carbonitrile (PubChem CID 53473272) has the molecular formula C21H24N2O8 and a molecular weight of 432.43 g/mol. Its IUPAC name is 4-(3,4-dimethoxyphenyl)-2-oxo-6-[[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]methyl]-1H-pyridine-3-carbonitrile.
| Compound Name | 4-(3,4-dimethoxyphenyl)-2-oxo-6-[[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]methyl]-1H-pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 53473272 |
| Molecular Formula | C21H24N2O8 |
| Molecular Weight | 432.43 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | 4-(3,4-dimethoxyphenyl)-2-oxo-6-[[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]methyl]-1H-pyridine-3-carbonitrile |
| SMILES | COc1ccc(-c2cc(C[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[nH]c(=O)c2C#N)cc1OC |
| InChI | InChI=1S/C21H24N2O8/c1-29-14-4-3-10(5-15(14)30-2)12-6-11(23-21(28)13(12)8-22)7-16-18(25)20(27)19(26)17(9-24)31-16/h3-6,16-20,24-27H,7,9H2,1-2H3,(H,23,28)/t16-,17+,18-,19+,20+/m0/s1 |
| InChIKey | CSFMYUCJQPAOJX-PXTPFGJHSA-N |
| XLogP | -0.68 |
| TPSA | 165.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.43 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |