C16H9BrFN3S — CID 122201915
5-amino-7-(4-bromo-3-fluorophenyl)-2,3-dihydro-1-benzothiophene-4,6-dicarbonitrile (PubChem CID 122201915) has the molecular formula C16H9BrFN3S and a molecular weight of 374.24 g/mol. Its IUPAC name is 5-amino-7-(4-bromo-3-fluorophenyl)-2,3-dihydro-1-benzothiophene-4,6-dicarbonitrile.
| Compound Name | 5-amino-7-(4-bromo-3-fluorophenyl)-2,3-dihydro-1-benzothiophene-4,6-dicarbonitrile |
|---|---|
| PubChem CID | 122201915 |
| Molecular Formula | C16H9BrFN3S |
| Molecular Weight | 374.24 g/mol |
| Exact Mass | 372.97 |
| IUPAC Name | 5-amino-7-(4-bromo-3-fluorophenyl)-2,3-dihydro-1-benzothiophene-4,6-dicarbonitrile |
| SMILES | N#Cc1c(N)c(C#N)c(-c2ccc(Br)c(F)c2)c2c1CCS2 |
| InChI | InChI=1S/C16H9BrFN3S/c17-12-2-1-8(5-13(12)18)14-11(7-20)15(21)10(6-19)9-3-4-22-16(9)14/h1-2,5H,3-4,21H2 |
| InChIKey | VDLCYYUFIBPQJR-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 73.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.24 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|