C24H19N3OS — CID 71579727
5-amino-2-(4-methoxyphenyl)-7-(4-methylphenyl)-2,3-dihydro-1-benzothiophene-4,6-dicarbonitrile (PubChem CID 71579727) has the molecular formula C24H19N3OS and a molecular weight of 397.50 g/mol. Its IUPAC name is 5-amino-2-(4-methoxyphenyl)-7-(4-methylphenyl)-2,3-dihydro-1-benzothiophene-4,6-dicarbonitrile.
| Compound Name | 5-amino-2-(4-methoxyphenyl)-7-(4-methylphenyl)-2,3-dihydro-1-benzothiophene-4,6-dicarbonitrile |
|---|---|
| PubChem CID | 71579727 |
| Molecular Formula | C24H19N3OS |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | 5-amino-2-(4-methoxyphenyl)-7-(4-methylphenyl)-2,3-dihydro-1-benzothiophene-4,6-dicarbonitrile |
| SMILES | COc1ccc(C2Cc3c(C#N)c(N)c(C#N)c(-c4ccc(C)cc4)c3S2)cc1 |
| InChI | InChI=1S/C24H19N3OS/c1-14-3-5-16(6-4-14)22-20(13-26)23(27)19(12-25)18-11-21(29-24(18)22)15-7-9-17(28-2)10-8-15/h3-10,21H,11,27H2,1-2H3 |
| InChIKey | ODMMTTITCRFBQR-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 82.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|