C30H22N4O3 — CID 139234554
5-amino-1,7-bis(4-methoxyphenyl)-3-oxo-2-phenyl-1H-isoindole-4,6-dicarbonitrile (PubChem CID 139234554) has the molecular formula C30H22N4O3 and a molecular weight of 486.53 g/mol. Its IUPAC name is 5-amino-1,7-bis(4-methoxyphenyl)-3-oxo-2-phenyl-1H-isoindole-4,6-dicarbonitrile.
| Compound Name | 5-amino-1,7-bis(4-methoxyphenyl)-3-oxo-2-phenyl-1H-isoindole-4,6-dicarbonitrile |
|---|---|
| PubChem CID | 139234554 |
| Molecular Formula | C30H22N4O3 |
| Molecular Weight | 486.53 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | 5-amino-1,7-bis(4-methoxyphenyl)-3-oxo-2-phenyl-1H-isoindole-4,6-dicarbonitrile |
| SMILES | COc1ccc(-c2c(C#N)c(N)c(C#N)c3c2C(c2ccc(OC)cc2)N(c2ccccc2)C3=O)cc1 |
| InChI | InChI=1S/C30H22N4O3/c1-36-21-12-8-18(9-13-21)25-23(16-31)28(33)24(17-32)26-27(25)29(19-10-14-22(37-2)15-11-19)34(30(26)35)20-6-4-3-5-7-20/h3-15,29H,33H2,1-2H3 |
| InChIKey | WRUCOPDWSOIODQ-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 112.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.53 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|