C26H17N3O2S — CID 10836634
2-amino-5-(benzenesulfonyl)-4,6-diphenylbenzene-1,3-dicarbonitrile (PubChem CID 10836634) has the molecular formula C26H17N3O2S and a molecular weight of 435.51 g/mol. Its IUPAC name is 2-amino-5-(benzenesulfonyl)-4,6-diphenylbenzene-1,3-dicarbonitrile.
| Compound Name | 2-amino-5-(benzenesulfonyl)-4,6-diphenylbenzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 10836634 |
| Molecular Formula | C26H17N3O2S |
| Molecular Weight | 435.51 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | 2-amino-5-(benzenesulfonyl)-4,6-diphenylbenzene-1,3-dicarbonitrile |
| SMILES | N#Cc1c(N)c(C#N)c(-c2ccccc2)c(S(=O)(=O)c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C26H17N3O2S/c27-16-21-23(18-10-4-1-5-11-18)26(32(30,31)20-14-8-3-9-15-20)24(22(17-28)25(21)29)19-12-6-2-7-13-19/h1-15H,29H2 |
| InChIKey | OJQIKOZQQTVKKS-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 107.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.51 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|