C19H12N4O — CID 15196712
5-amino-2,4-dicyano-3-phenyl-6-pyridin-1-ium-1-ylphenolate (PubChem CID 15196712) has the molecular formula C19H12N4O and a molecular weight of 312.33 g/mol. Its IUPAC name is 5-amino-2,4-dicyano-3-phenyl-6-pyridin-1-ium-1-ylphenolate.
| Compound Name | 5-amino-2,4-dicyano-3-phenyl-6-pyridin-1-ium-1-ylphenolate |
|---|---|
| PubChem CID | 15196712 |
| Molecular Formula | C19H12N4O |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | 5-amino-2,4-dicyano-3-phenyl-6-pyridin-1-ium-1-ylphenolate |
| SMILES | N#Cc1c(N)c(-[n+]2ccccc2)c([O-])c(C#N)c1-c1ccccc1 |
| InChI | InChI=1S/C19H12N4O/c20-11-14-16(13-7-3-1-4-8-13)15(12-21)19(24)18(17(14)22)23-9-5-2-6-10-23/h1-10H,22H2 |
| InChIKey | VSFADADCCPYLCQ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|