C20H12FN3 — CID 172519636
2-amino-4-fluoro-5-isocyano-3,6-diphenylbenzonitrile (PubChem CID 172519636) has the molecular formula C20H12FN3 and a molecular weight of 313.34 g/mol. Its IUPAC name is 2-amino-4-fluoro-5-isocyano-3,6-diphenylbenzonitrile.
| Compound Name | 2-amino-4-fluoro-5-isocyano-3,6-diphenylbenzonitrile |
|---|---|
| PubChem CID | 172519636 |
| Molecular Formula | C20H12FN3 |
| Molecular Weight | 313.34 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 2-amino-4-fluoro-5-isocyano-3,6-diphenylbenzonitrile |
| SMILES | [C-]#[N+]c1c(F)c(-c2ccccc2)c(N)c(C#N)c1-c1ccccc1 |
| InChI | InChI=1S/C20H12FN3/c1-24-20-16(13-8-4-2-5-9-13)15(12-22)19(23)17(18(20)21)14-10-6-3-7-11-14/h2-11H,23H2 |
| InChIKey | ZONYULKDNRWDEX-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 54.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.34 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|