C28H13F2N5O — CID 159609421
2,3-difluoro-7-isocyano-8-phenoxazin-10-yl-5-phenylquinoxaline-6-carbonitrile (PubChem CID 159609421) has the molecular formula C28H13F2N5O and a molecular weight of 473.44 g/mol. Its IUPAC name is 2,3-difluoro-7-isocyano-8-phenoxazin-10-yl-5-phenylquinoxaline-6-carbonitrile.
| Compound Name | 2,3-difluoro-7-isocyano-8-phenoxazin-10-yl-5-phenylquinoxaline-6-carbonitrile |
|---|---|
| PubChem CID | 159609421 |
| Molecular Formula | C28H13F2N5O |
| Molecular Weight | 473.44 g/mol |
| Exact Mass | 473.11 |
| IUPAC Name | 2,3-difluoro-7-isocyano-8-phenoxazin-10-yl-5-phenylquinoxaline-6-carbonitrile |
| SMILES | [C-]#[N+]c1c(C#N)c(-c2ccccc2)c2nc(F)c(F)nc2c1N1c2ccccc2Oc2ccccc21 |
| InChI | InChI=1S/C28H13F2N5O/c1-32-23-17(15-31)22(16-9-3-2-4-10-16)24-25(34-28(30)27(29)33-24)26(23)35-18-11-5-7-13-20(18)36-21-14-8-6-12-19(21)35/h2-14H |
| InChIKey | YIVUCMAPDGIPRC-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.44 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|