C63H36N6O3 — CID 140878435
4-[3-(4-cyanophenyl)-5-(4-isocyanophenyl)-2,4,6-tri(phenoxazin-10-yl)phenyl]benzonitrile (PubChem CID 140878435) has the molecular formula C63H36N6O3 and a molecular weight of 925.02 g/mol. Its IUPAC name is 4-[3-(4-cyanophenyl)-5-(4-isocyanophenyl)-2,4,6-tri(phenoxazin-10-yl)phenyl]benzonitrile.
| Compound Name | 4-[3-(4-cyanophenyl)-5-(4-isocyanophenyl)-2,4,6-tri(phenoxazin-10-yl)phenyl]benzonitrile |
|---|---|
| PubChem CID | 140878435 |
| Molecular Formula | C63H36N6O3 |
| Molecular Weight | 925.02 g/mol |
| Exact Mass | 924.28 |
| IUPAC Name | 4-[3-(4-cyanophenyl)-5-(4-isocyanophenyl)-2,4,6-tri(phenoxazin-10-yl)phenyl]benzonitrile |
| SMILES | [C-]#[N+]c1ccc(-c2c(N3c4ccccc4Oc4ccccc43)c(-c3ccc(C#N)cc3)c(N3c4ccccc4Oc4ccccc43)c(-c3ccc(C#N)cc3)c2N2c3ccccc3Oc3ccccc32)cc1 |
| InChI | InChI=1S/C63H36N6O3/c1-66-45-36-34-44(35-37-45)60-62(68-48-16-4-10-22-54(48)71-55-23-11-5-17-49(55)68)58(42-30-26-40(38-64)27-31-42)61(67-46-14-2-8-20-52(46)70-53-21-9-3-15-47(53)67)59(43-32-28-41(39-65)29-33-43)63(60)69-50-18-6-12-24-56(50)72-57-25-13-7-19-51(57)69/h2-37H |
| InChIKey | AZMCKKUMUDQGFX-UHFFFAOYSA-N |
| XLogP | 17.71 |
| TPSA | 89.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 925.02 |
| LogP ≤ 5 | 17.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|