C20H11N3O — CID 159346835
10-(3,5-diisocyanophenyl)phenoxazine (PubChem CID 159346835) has the molecular formula C20H11N3O and a molecular weight of 309.33 g/mol. Its IUPAC name is 10-(3,5-diisocyanophenyl)phenoxazine.
| Compound Name | 10-(3,5-diisocyanophenyl)phenoxazine |
|---|---|
| PubChem CID | 159346835 |
| Molecular Formula | C20H11N3O |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | 10-(3,5-diisocyanophenyl)phenoxazine |
| SMILES | [C-]#[N+]c1cc([N+]#[C-])cc(N2c3ccccc3Oc3ccccc32)c1 |
| InChI | InChI=1S/C20H11N3O/c1-21-14-11-15(22-2)13-16(12-14)23-17-7-3-5-9-19(17)24-20-10-6-4-8-18(20)23/h3-13H |
| InChIKey | USXNZSKVAMXNJM-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 21.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|