C24H15NO5S2 — CID 144851825
2-phenoxazin-10-ylthianthrene 5,5,10,10-tetraoxide (PubChem CID 144851825) has the molecular formula C24H15NO5S2 and a molecular weight of 461.52 g/mol. Its IUPAC name is 2-phenoxazin-10-ylthianthrene 5,5,10,10-tetraoxide.
| Compound Name | 2-phenoxazin-10-ylthianthrene 5,5,10,10-tetraoxide |
|---|---|
| PubChem CID | 144851825 |
| Molecular Formula | C24H15NO5S2 |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.04 |
| IUPAC Name | 2-phenoxazin-10-ylthianthrene 5,5,10,10-tetraoxide |
| SMILES | O=S1(=O)c2ccccc2S(=O)(=O)c2cc(N3c4ccccc4Oc4ccccc43)ccc21 |
| InChI | InChI=1S/C24H15NO5S2/c26-31(27)21-11-5-6-12-22(21)32(28,29)24-15-16(13-14-23(24)31)25-17-7-1-3-9-19(17)30-20-10-4-2-8-18(20)25/h1-15H |
| InChIKey | XUASJHQLQXDCHL-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |