C68H44N2O6S2 — CID 130396372
2-[5-(10,10-dioxophenoxathiin-2-yl)-7,7,14,14-tetraphenylquinolino[2,3-b]acridin-12-yl]phenoxathiine 10,10-dioxide (PubChem CID 130396372) has the molecular formula C68H44N2O6S2 and a molecular weight of 1049.24 g/mol. Its IUPAC name is 2-[5-(10,10-dioxophenoxathiin-2-yl)-7,7,14,14-tetraphenylquinolino[2,3-b]acridin-12-yl]phenoxathiine 10,10-dioxide.
| Compound Name | 2-[5-(10,10-dioxophenoxathiin-2-yl)-7,7,14,14-tetraphenylquinolino[2,3-b]acridin-12-yl]phenoxathiine 10,10-dioxide |
|---|---|
| PubChem CID | 130396372 |
| Molecular Formula | C68H44N2O6S2 |
| Molecular Weight | 1049.24 g/mol |
| Exact Mass | 1048.26 |
| IUPAC Name | 2-[5-(10,10-dioxophenoxathiin-2-yl)-7,7,14,14-tetraphenylquinolino[2,3-b]acridin-12-yl]phenoxathiine 10,10-dioxide |
| SMILES | O=S1(=O)c2ccccc2Oc2ccc(N3c4ccccc4C(c4ccccc4)(c4ccccc4)c4cc5c(cc43)C(c3ccccc3)(c3ccccc3)c3ccccc3N5c3ccc4c(c3)S(=O)(=O)c3ccccc3O4)cc21 |
| InChI | InChI=1S/C68H44N2O6S2/c71-77(72)63-35-19-17-33-59(63)75-61-39-37-49(41-65(61)77)69-55-31-15-13-29-51(55)67(45-21-5-1-6-22-45,46-23-7-2-8-24-46)53-43-58-54(44-57(53)69)68(47-25-9-3-10-26-47,48-27-11-4-12-28-48)52-30-14-16-32-56(52)70(58)50-38-40-62-66(42-50)78(73,74)64-36-20-18-34-60(64)76-62/h1-44H |
| InChIKey | LROGXVAPHCWDMT-UHFFFAOYSA-N |
| XLogP | 15.90 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1049.24 |
| LogP ≤ 5 | 15.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |