C27H21NO3S — CID 130397726
2-(9,9-dimethylacridin-10-yl)phenoxathiine 10,10-dioxide (PubChem CID 130397726) has the molecular formula C27H21NO3S and a molecular weight of 439.54 g/mol. Its IUPAC name is 2-(9,9-dimethylacridin-10-yl)phenoxathiine 10,10-dioxide.
| Compound Name | 2-(9,9-dimethylacridin-10-yl)phenoxathiine 10,10-dioxide |
|---|---|
| PubChem CID | 130397726 |
| Molecular Formula | C27H21NO3S |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | 2-(9,9-dimethylacridin-10-yl)phenoxathiine 10,10-dioxide |
| SMILES | CC1(C)c2ccccc2N(c2ccc3c(c2)S(=O)(=O)c2ccccc2O3)c2ccccc21 |
| InChI | InChI=1S/C27H21NO3S/c1-27(2)19-9-3-5-11-21(19)28(22-12-6-4-10-20(22)27)18-15-16-24-26(17-18)32(29,30)25-14-8-7-13-23(25)31-24/h3-17H,1-2H3 |
| InChIKey | LMLHITACKQFZRJ-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |