C18H10O6S2 — CID 146334062
[1,4]benzoxathiino[3,2-b]phenoxathiine 12,12,14,14-tetraoxide (PubChem CID 146334062) has the molecular formula C18H10O6S2 and a molecular weight of 386.41 g/mol. Its IUPAC name is [1,4]benzoxathiino[3,2-b]phenoxathiine 12,12,14,14-tetraoxide.
| Compound Name | [1,4]benzoxathiino[3,2-b]phenoxathiine 12,12,14,14-tetraoxide |
|---|---|
| PubChem CID | 146334062 |
| Molecular Formula | C18H10O6S2 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 385.99 |
| IUPAC Name | [1,4]benzoxathiino[3,2-b]phenoxathiine 12,12,14,14-tetraoxide |
| SMILES | O=S1(=O)c2ccccc2Oc2cc3c(cc21)S(=O)(=O)c1ccccc1O3 |
| InChI | InChI=1S/C18H10O6S2/c19-25(20)15-7-3-1-5-11(15)23-13-9-14-18(10-17(13)25)26(21,22)16-8-4-2-6-12(16)24-14/h1-10H |
| InChIKey | GNKAWFXKOKSXME-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |