C14H7IO6S — CID 172505333
10-hydroxy-8-iodo-12,12-dioxobenzo[c][2,5]benzoxathiocine-6,11-dione (PubChem CID 172505333) has the molecular formula C14H7IO6S and a molecular weight of 430.18 g/mol. Its IUPAC name is 10-hydroxy-8-iodo-12,12-dioxobenzo[c][2,5]benzoxathiocine-6,11-dione.
| Compound Name | 10-hydroxy-8-iodo-12,12-dioxobenzo[c][2,5]benzoxathiocine-6,11-dione |
|---|---|
| PubChem CID | 172505333 |
| Molecular Formula | C14H7IO6S |
| Molecular Weight | 430.18 g/mol |
| Exact Mass | 429.90 |
| IUPAC Name | 10-hydroxy-8-iodo-12,12-dioxobenzo[c][2,5]benzoxathiocine-6,11-dione |
| SMILES | O=C1Oc2ccccc2S(=O)(=O)C(=O)c2c(O)cc(I)cc21 |
| InChI | InChI=1S/C14H7IO6S/c15-7-5-8-12(9(16)6-7)14(18)22(19,20)11-4-2-1-3-10(11)21-13(8)17/h1-6,16H |
| InChIKey | QRLLYDHZEIPORS-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.18 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|