C13H5I3O5S — CID 172505323
7,9,10-triiodo-5,5-dioxobenzo[c][1,6,2]benzodioxathiocin-12-one (PubChem CID 172505323) has the molecular formula C13H5I3O5S and a molecular weight of 653.96 g/mol. Its IUPAC name is 7,9,10-triiodo-5,5-dioxobenzo[c][1,6,2]benzodioxathiocin-12-one.
| Compound Name | 7,9,10-triiodo-5,5-dioxobenzo[c][1,6,2]benzodioxathiocin-12-one |
|---|---|
| PubChem CID | 172505323 |
| Molecular Formula | C13H5I3O5S |
| Molecular Weight | 653.96 g/mol |
| Exact Mass | 653.70 |
| IUPAC Name | 7,9,10-triiodo-5,5-dioxobenzo[c][1,6,2]benzodioxathiocin-12-one |
| SMILES | O=C1Oc2c(I)c(I)cc(I)c2OS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C13H5I3O5S/c14-7-5-8(15)11-12(10(7)16)20-13(17)6-3-1-2-4-9(6)22(18,19)21-11/h1-5H |
| InChIKey | SAJIBGANMMWJNH-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.96 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|