C12H6I2O2 — CID 172505013
1,4-diiododibenzo-p-dioxin (PubChem CID 172505013) has the molecular formula C12H6I2O2 and a molecular weight of 435.99 g/mol. Its IUPAC name is 1,4-diiododibenzo-p-dioxin.
| Compound Name | 1,4-diiododibenzo-p-dioxin |
|---|---|
| PubChem CID | 172505013 |
| Molecular Formula | C12H6I2O2 |
| Molecular Weight | 435.99 g/mol |
| Exact Mass | 435.85 |
| IUPAC Name | 1,4-diiododibenzo-p-dioxin |
| SMILES | Ic1ccc(I)c2c1Oc1ccccc1O2 |
| InChI | InChI=1S/C12H6I2O2/c13-7-5-6-8(14)12-11(7)15-9-3-1-2-4-10(9)16-12/h1-6H |
| InChIKey | JOFRFOPTQLXTQR-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.99 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|