About 2,4-diiodo-9H-xanthen-3-ol
2,4-diiodo-9H-xanthen-3-ol (PubChem CID 91488087) has the molecular formula C13H8I2O2
and a molecular weight of 450.01 g/mol. Its IUPAC name is 2,4-diiodo-9H-xanthen-3-ol.
Molecular Properties
| Compound Name | 2,4-diiodo-9H-xanthen-3-ol |
| PubChem CID | 91488087 |
| Molecular Formula | C13H8I2O2 |
| Molecular Weight | 450.01 g/mol |
| Exact Mass | 449.86 |
| IUPAC Name | 2,4-diiodo-9H-xanthen-3-ol |
| SMILES | Oc1c(I)cc2c(c1I)Oc1ccccc1C2 |
| InChI | InChI=1S/C13H8I2O2/c14-9-6-8-5-7-3-1-2-4-10(7)17-13(8)11(15)12(9)16/h1-4,6,16H,5H2 |
| InChIKey | SYCGMHGEKOXPAV-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 450.01 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2,4-diiodo-9H-xanthen-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-diiodo-9H-xanthen-3-ol?
The IUPAC name of 2,4-diiodo-9H-xanthen-3-ol (CID 91488087) is 2,4-diiodo-9H-xanthen-3-ol.
What is the SMILES notation for 2,4-diiodo-9H-xanthen-3-ol?
The canonical SMILES for 2,4-diiodo-9H-xanthen-3-ol is Oc1c(I)cc2c(c1I)Oc1ccccc1C2.
What is the InChIKey of 2,4-diiodo-9H-xanthen-3-ol?
The InChIKey is SYCGMHGEKOXPAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8I2O2/c14-9-6-8-5-7-3-1-2-4-10(7)17-13(8)11(15)12(9)16/h1-4,6,16H,5H2.
What are the key properties of 2,4-diiodo-9H-xanthen-3-ol?
2,4-diiodo-9H-xanthen-3-ol has a molecular weight of 450.01 g/mol, XLogP of 4.30, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-diiodo-9H-xanthen-3-ol is sourced from PubChem (CID 91488087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).