C10H8N2O2S — CID 134179866
thieno[3,4-b][1,4]benzodioxine-1,3-diamine (PubChem CID 134179866) has the molecular formula C10H8N2O2S and a molecular weight of 220.25 g/mol. Its IUPAC name is thieno[3,4-b][1,4]benzodioxine-1,3-diamine.
| Compound Name | thieno[3,4-b][1,4]benzodioxine-1,3-diamine |
|---|---|
| PubChem CID | 134179866 |
| Molecular Formula | C10H8N2O2S |
| Molecular Weight | 220.25 g/mol |
| Exact Mass | 220.03 |
| IUPAC Name | thieno[3,4-b][1,4]benzodioxine-1,3-diamine |
| SMILES | Nc1sc(N)c2c1Oc1ccccc1O2 |
| InChI | InChI=1S/C10H8N2O2S/c11-9-7-8(10(12)15-9)14-6-4-2-1-3-5(6)13-7/h1-4H,11-12H2 |
| InChIKey | XEQXDAQHUMIJGU-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.25 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |