C16H8Cl4O4 — CID 66898767
1,4-dioxine;1,2,3,4-tetrachlorodibenzo-p-dioxin (PubChem CID 66898767) has the molecular formula C16H8Cl4O4 and a molecular weight of 406.05 g/mol. Its IUPAC name is 1,4-dioxine;1,2,3,4-tetrachlorodibenzo-p-dioxin.
| Compound Name | 1,4-dioxine;1,2,3,4-tetrachlorodibenzo-p-dioxin |
|---|---|
| PubChem CID | 66898767 |
| Molecular Formula | C16H8Cl4O4 |
| Molecular Weight | 406.05 g/mol |
| Exact Mass | 403.92 |
| IUPAC Name | 1,4-dioxine;1,2,3,4-tetrachlorodibenzo-p-dioxin |
| SMILES | C1=COC=CO1.Clc1c(Cl)c(Cl)c2c(c1Cl)Oc1ccccc1O2 |
| InChI | InChI=1S/C12H4Cl4O2.C4H4O2/c13-7-8(14)10(16)12-11(9(7)15)17-5-3-1-2-4-6(5)18-12;1-2-6-4-3-5-1/h1-4H;1-4H |
| InChIKey | YPZGWZQKKGWBBO-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.05 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|