C13H6I2O5S — CID 172504814
1,4-diiodo-6,6-dioxobenzo[c][1,5,2]benzodioxathiocin-12-one (PubChem CID 172504814) has the molecular formula C13H6I2O5S and a molecular weight of 528.06 g/mol. Its IUPAC name is 1,4-diiodo-6,6-dioxobenzo[c][1,5,2]benzodioxathiocin-12-one.
| Compound Name | 1,4-diiodo-6,6-dioxobenzo[c][1,5,2]benzodioxathiocin-12-one |
|---|---|
| PubChem CID | 172504814 |
| Molecular Formula | C13H6I2O5S |
| Molecular Weight | 528.06 g/mol |
| Exact Mass | 527.80 |
| IUPAC Name | 1,4-diiodo-6,6-dioxobenzo[c][1,5,2]benzodioxathiocin-12-one |
| SMILES | O=C1Oc2ccccc2S(=O)(=O)Oc2c(I)ccc(I)c21 |
| InChI | InChI=1S/C13H6I2O5S/c14-7-5-6-8(15)12-11(7)13(16)19-9-3-1-2-4-10(9)21(17,18)20-12/h1-6H |
| InChIKey | YDQKLNRSJDLQRS-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.06 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|