C11H12O5S2 — CID 176765853
spiro[2,4,1λ6-benzodioxathiine-3,4'-thiane] 1,1,1'-trioxide (PubChem CID 176765853) has the molecular formula C11H12O5S2 and a molecular weight of 288.35 g/mol. Its IUPAC name is spiro[2,4,1λ6-benzodioxathiine-3,4'-thiane] 1,1,1'-trioxide.
| Compound Name | spiro[2,4,1λ6-benzodioxathiine-3,4'-thiane] 1,1,1'-trioxide |
|---|---|
| PubChem CID | 176765853 |
| Molecular Formula | C11H12O5S2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.01 |
| IUPAC Name | spiro[2,4,1λ6-benzodioxathiine-3,4'-thiane] 1,1,1'-trioxide |
| SMILES | O=S1CCC2(CC1)Oc1ccccc1S(=O)(=O)O2 |
| InChI | InChI=1S/C11H12O5S2/c12-17-7-5-11(6-8-17)15-9-3-1-2-4-10(9)18(13,14)16-11/h1-4H,5-8H2 |
| InChIKey | XSKXWYNGPQZHBC-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|