C10H10O4S — CID 176765807
3-ethenyl-3-methyl-2,4,1λ6-benzodioxathiine 1,1-dioxide (PubChem CID 176765807) has the molecular formula C10H10O4S and a molecular weight of 226.25 g/mol. Its IUPAC name is 3-ethenyl-3-methyl-2,4,1λ6-benzodioxathiine 1,1-dioxide.
| Compound Name | 3-ethenyl-3-methyl-2,4,1λ6-benzodioxathiine 1,1-dioxide |
|---|---|
| PubChem CID | 176765807 |
| Molecular Formula | C10H10O4S |
| Molecular Weight | 226.25 g/mol |
| Exact Mass | 226.03 |
| IUPAC Name | 3-ethenyl-3-methyl-2,4,1λ6-benzodioxathiine 1,1-dioxide |
| SMILES | C=CC1(C)Oc2ccccc2S(=O)(=O)O1 |
| InChI | InChI=1S/C10H10O4S/c1-3-10(2)13-8-6-4-5-7-9(8)15(11,12)14-10/h3-7H,1H2,2H3 |
| InChIKey | RCEKIHHHBSDJBZ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.25 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|