C15H16O4 — CID 86217763
3-(3-ethenyl-2H-1,4-benzodioxin-3-yl)pentane-2,4-dione (PubChem CID 86217763) has the molecular formula C15H16O4 and a molecular weight of 260.29 g/mol. Its IUPAC name is 3-(3-ethenyl-2H-1,4-benzodioxin-3-yl)pentane-2,4-dione.
| Compound Name | 3-(3-ethenyl-2H-1,4-benzodioxin-3-yl)pentane-2,4-dione |
|---|---|
| PubChem CID | 86217763 |
| Molecular Formula | C15H16O4 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 3-(3-ethenyl-2H-1,4-benzodioxin-3-yl)pentane-2,4-dione |
| SMILES | C=CC1(C(C(C)=O)C(C)=O)COc2ccccc2O1 |
| InChI | InChI=1S/C15H16O4/c1-4-15(14(10(2)16)11(3)17)9-18-12-7-5-6-8-13(12)19-15/h4-8,14H,1,9H2,2-3H3 |
| InChIKey | WMKCUISXZUBZFQ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|