C10H12N2O4 — CID 7114748
(3S)-3-methoxy-2H-1,4-benzodioxine-3-carbohydrazide (PubChem CID 7114748) has the molecular formula C10H12N2O4 and a molecular weight of 224.22 g/mol. Its IUPAC name is (3S)-3-methoxy-2H-1,4-benzodioxine-3-carbohydrazide.
| Compound Name | (3S)-3-methoxy-2H-1,4-benzodioxine-3-carbohydrazide |
|---|---|
| PubChem CID | 7114748 |
| Molecular Formula | C10H12N2O4 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | (3S)-3-methoxy-2H-1,4-benzodioxine-3-carbohydrazide |
| SMILES | CO[C@@]1(C(=O)NN)COc2ccccc2O1 |
| InChI | InChI=1S/C10H12N2O4/c1-14-10(9(13)12-11)6-15-7-4-2-3-5-8(7)16-10/h2-5H,6,11H2,1H3,(H,12,13)/t10-/m0/s1 |
| InChIKey | OEHXYEPGCQALMS-JTQLQIEISA-N |
| XLogP | -0.21 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|