C12H14O2 — CID 15106683
1a,2,2-trimethyl-7bH-oxireno[2,3-c]chromene (PubChem CID 15106683) has the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. Its IUPAC name is 1a,2,2-trimethyl-7bH-oxireno[2,3-c]chromene.
| Compound Name | 1a,2,2-trimethyl-7bH-oxireno[2,3-c]chromene |
|---|---|
| PubChem CID | 15106683 |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | 1a,2,2-trimethyl-7bH-oxireno[2,3-c]chromene |
| SMILES | CC1(C)Oc2ccccc2C2OC21C |
| InChI | InChI=1S/C12H14O2/c1-11(2)12(3)10(14-12)8-6-4-5-7-9(8)13-11/h4-7,10H,1-3H3 |
| InChIKey | DFOVDCJIOLPNEL-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|