About 1a,2,2-trimethyl-7bH-oxireno[2,3-c]chromene
1a,2,2-trimethyl-7bH-oxireno[2,3-c]chromene (PubChem CID 15106683) has the molecular formula C12H14O2
and a molecular weight of 190.24 g/mol. Its IUPAC name is 1a,2,2-trimethyl-7bH-oxireno[2,3-c]chromene.
Molecular Properties
| Compound Name | 1a,2,2-trimethyl-7bH-oxireno[2,3-c]chromene |
| PubChem CID | 15106683 |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | 1a,2,2-trimethyl-7bH-oxireno[2,3-c]chromene |
| SMILES | CC1(C)Oc2ccccc2C2OC21C |
| InChI | InChI=1S/C12H14O2/c1-11(2)12(3)10(14-12)8-6-4-5-7-9(8)13-11/h4-7,10H,1-3H3 |
| InChIKey | DFOVDCJIOLPNEL-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1a,2,2-trimethyl-7bH-oxireno[2,3-c]chromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1a,2,2-trimethyl-7bH-oxireno[2,3-c]chromene?
The IUPAC name of 1a,2,2-trimethyl-7bH-oxireno[2,3-c]chromene (CID 15106683) is 1a,2,2-trimethyl-7bH-oxireno[2,3-c]chromene.
What is the SMILES notation for 1a,2,2-trimethyl-7bH-oxireno[2,3-c]chromene?
The canonical SMILES for 1a,2,2-trimethyl-7bH-oxireno[2,3-c]chromene is CC1(C)Oc2ccccc2C2OC21C.
What is the InChIKey of 1a,2,2-trimethyl-7bH-oxireno[2,3-c]chromene?
The InChIKey is DFOVDCJIOLPNEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O2/c1-11(2)12(3)10(14-12)8-6-4-5-7-9(8)13-11/h4-7,10H,1-3H3.
What are the key properties of 1a,2,2-trimethyl-7bH-oxireno[2,3-c]chromene?
1a,2,2-trimethyl-7bH-oxireno[2,3-c]chromene has a molecular weight of 190.24 g/mol, XLogP of 2.69, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1a,2,2-trimethyl-7bH-oxireno[2,3-c]chromene is sourced from PubChem (CID 15106683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).