C13H13NO2 — CID 15925478
(1aR,7bR)-1a,2,2-trimethyl-7bH-oxireno[2,3-c]chromene-6-carbonitrile (PubChem CID 15925478) has the molecular formula C13H13NO2 and a molecular weight of 215.25 g/mol. Its IUPAC name is (1aR,7bR)-1a,2,2-trimethyl-7bH-oxireno[2,3-c]chromene-6-carbonitrile.
| Compound Name | (1aR,7bR)-1a,2,2-trimethyl-7bH-oxireno[2,3-c]chromene-6-carbonitrile |
|---|---|
| PubChem CID | 15925478 |
| Molecular Formula | C13H13NO2 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | (1aR,7bR)-1a,2,2-trimethyl-7bH-oxireno[2,3-c]chromene-6-carbonitrile |
| SMILES | CC1(C)Oc2ccc(C#N)cc2[C@H]2O[C@]21C |
| InChI | InChI=1S/C13H13NO2/c1-12(2)13(3)11(16-13)9-6-8(7-14)4-5-10(9)15-12/h4-6,11H,1-3H3/t11-,13-/m1/s1 |
| InChIKey | XBFYOFWLBKAYPQ-DGCLKSJQSA-N |
| XLogP | 2.56 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|