C19H18N2O5 — CID 22122801
[6-cyano-2,2,3-trimethyl-4-[(2-oxo-1H-pyridin-4-yl)oxy]-4H-chromen-3-yl] formate (PubChem CID 22122801) has the molecular formula C19H18N2O5 and a molecular weight of 354.36 g/mol. Its IUPAC name is [6-cyano-2,2,3-trimethyl-4-[(2-oxo-1H-pyridin-4-yl)oxy]-4H-chromen-3-yl] formate.
| Compound Name | [6-cyano-2,2,3-trimethyl-4-[(2-oxo-1H-pyridin-4-yl)oxy]-4H-chromen-3-yl] formate |
|---|---|
| PubChem CID | 22122801 |
| Molecular Formula | C19H18N2O5 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | [6-cyano-2,2,3-trimethyl-4-[(2-oxo-1H-pyridin-4-yl)oxy]-4H-chromen-3-yl] formate |
| SMILES | CC1(C)Oc2ccc(C#N)cc2C(Oc2cc[nH]c(=O)c2)C1(C)OC=O |
| InChI | InChI=1S/C19H18N2O5/c1-18(2)19(3,24-11-22)17(25-13-6-7-21-16(23)9-13)14-8-12(10-20)4-5-15(14)26-18/h4-9,11,17H,1-3H3,(H,21,23) |
| InChIKey | BGEHYEMIHHEMLX-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 101.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|