C14H13F5O2 — CID 19387051
1a,2,2-trimethyl-6-(1,1,2,2,2-pentafluoroethyl)-7bH-oxireno[2,3-c]chromene (PubChem CID 19387051) has the molecular formula C14H13F5O2 and a molecular weight of 308.25 g/mol. Its IUPAC name is 1a,2,2-trimethyl-6-(1,1,2,2,2-pentafluoroethyl)-7bH-oxireno[2,3-c]chromene.
| Compound Name | 1a,2,2-trimethyl-6-(1,1,2,2,2-pentafluoroethyl)-7bH-oxireno[2,3-c]chromene |
|---|---|
| PubChem CID | 19387051 |
| Molecular Formula | C14H13F5O2 |
| Molecular Weight | 308.25 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 1a,2,2-trimethyl-6-(1,1,2,2,2-pentafluoroethyl)-7bH-oxireno[2,3-c]chromene |
| SMILES | CC1(C)Oc2ccc(C(F)(F)C(F)(F)F)cc2C2OC21C |
| InChI | InChI=1S/C14H13F5O2/c1-11(2)12(3)10(21-12)8-6-7(4-5-9(8)20-11)13(15,16)14(17,18)19/h4-6,10H,1-3H3 |
| InChIKey | UTMSSTHWHGPNLT-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.25 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|