C20H17F5N2O4 — CID 19387024
N-[[2,2-dimethyl-4-(2-oxo-1-pyridinyl)-6-(1,1,2,2,2-pentafluoroethyl)chromen-3-yl]methyl]-N-hydroxyformamide (PubChem CID 19387024) has the molecular formula C20H17F5N2O4 and a molecular weight of 444.36 g/mol. Its IUPAC name is N-[[2,2-dimethyl-4-(2-oxo-1-pyridinyl)-6-(1,1,2,2,2-pentafluoroethyl)chromen-3-yl]methyl]-N-hydroxyformamide.
| Compound Name | N-[[2,2-dimethyl-4-(2-oxo-1-pyridinyl)-6-(1,1,2,2,2-pentafluoroethyl)chromen-3-yl]methyl]-N-hydroxyformamide |
|---|---|
| PubChem CID | 19387024 |
| Molecular Formula | C20H17F5N2O4 |
| Molecular Weight | 444.36 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | N-[[2,2-dimethyl-4-(2-oxo-1-pyridinyl)-6-(1,1,2,2,2-pentafluoroethyl)chromen-3-yl]methyl]-N-hydroxyformamide |
| SMILES | CC1(C)Oc2ccc(C(F)(F)C(F)(F)F)cc2C(n2ccccc2=O)=C1CN(O)C=O |
| InChI | InChI=1S/C20H17F5N2O4/c1-18(2)14(10-26(30)11-28)17(27-8-4-3-5-16(27)29)13-9-12(6-7-15(13)31-18)19(21,22)20(23,24)25/h3-9,11,30H,10H2,1-2H3 |
| InChIKey | GVVZIWSBUCDXSC-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.36 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|